3-(5-(4-chlorophenyl)furan-2-yl)acrylic&
Modify Date: 2025-08-27 12:44:53
3-(5-(4-chlorophenyl)furan-2-yl)acrylic& structure
|
Common Name | 3-(5-(4-chlorophenyl)furan-2-yl)acrylic& | ||
|---|---|---|---|---|
| CAS Number | 58110-37-5 | Molecular Weight | 248.66200 | |
| Density | 1.343g/cm3 | Boiling Point | 417.6ºC at 760 mmHg | |
| Molecular Formula | C13H9ClO3 | Melting Point | 195-199ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 206.4ºC | |
| Symbol |
GHS05, GHS09 |
Signal Word | Danger | |
| Name | 3-(5-(4-chlorophenyl)furan-2-yl)acrylic& |
|---|---|
| Synonym | More Synonyms |
| Density | 1.343g/cm3 |
|---|---|
| Boiling Point | 417.6ºC at 760 mmHg |
| Melting Point | 195-199ºC(lit.) |
| Molecular Formula | C13H9ClO3 |
| Molecular Weight | 248.66200 |
| Flash Point | 206.4ºC |
| Exact Mass | 248.02400 |
| PSA | 50.44000 |
| LogP | 3.69780 |
| Index of Refraction | 1.625 |
| InChIKey | FPSINWFYJYHUBV-SOFGYWHQSA-N |
| SMILES | O=C(O)C=Cc1ccc(-c2ccc(Cl)cc2)o1 |
| Symbol |
GHS05, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318-H400 |
| Precautionary Statements | P273-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,N |
| Risk Phrases | 41-50/53 |
| Safety Phrases | 26-39-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD00192863 |