2-(furan-2-carbonyl)benzoic acid structure
|
Common Name | 2-(furan-2-carbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 57901-54-9 | Molecular Weight | 216.19000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(furan-2-carbonyl)benzoic acid |
|---|
| Molecular Formula | C12H8O4 |
|---|---|
| Molecular Weight | 216.19000 |
| Exact Mass | 216.04200 |
| PSA | 67.51000 |
| LogP | 2.20880 |
| InChIKey | LOQBQVAJOUMEIG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)c1ccco1 |
|
~14%
2-(furan-2-carb... CAS#:57901-54-9 |
| Literature: Probiodrug AG Patent: US2006/229357 A1, 2006 ; Location in patent: Page/Page column 21 ; US 20060229357 A1 |
|
~%
2-(furan-2-carb... CAS#:57901-54-9 |
| Literature: Lim, Chae Jo; Lee, Ka Eun; Lee, Byung Ho; Oh, Kwang-Seok; Yi, Kyu Yang Bulletin of the Korean Chemical Society, 2012 , vol. 33, # 7 p. 2389 - 2392 |
|
~%
2-(furan-2-carb... CAS#:57901-54-9 |
| Literature: Lopes; Pinto; Costa Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 2 p. 621 - 622 |