PTH-serine structure
|
Common Name | PTH-serine | ||
|---|---|---|---|---|
| CAS Number | 5789-22-0 | Molecular Weight | 222.26400 | |
| Density | 1.46g/cm3 | Boiling Point | 362.5ºC at 760mmHg | |
| Molecular Formula | C10H10N2O2S | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 173ºC | |
| Name | pth-serine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 362.5ºC at 760mmHg |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.26400 |
| Flash Point | 173ºC |
| Exact Mass | 222.04600 |
| PSA | 84.66000 |
| LogP | 0.66240 |
| Index of Refraction | 1.712 |
| InChIKey | HRXXSWPUYDARQL-UHFFFAOYSA-N |
| SMILES | O=C1C(CO)NC(=S)N1c1ccccc1 |
| RIDADR | NONH for all modes of transport |
|---|
|
~%
PTH-serine CAS#:5789-22-0 |
| Literature: Ingram Journal of the Chemical Society, 1953 , p. 3717 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| serine 3-phenylthiohydantoin |
| PTH-DL-Serine Phenylthiohydantoin-DL-serine |
| D,L-serine N-phenylthiohydantoin |
| PTH-DL-SERINE |
| PHENYLTHIOHYDANTOIN SERINE |
| 5-Hydroxymethyl-3-phenyl-2-thioxo-imidazolidin-4-on |
| 5-hydroxymethyl-3-phenyl-2-thioxo-imidazolidin-4-one |
| 3-Phenyl-5-hydroxymethyl-thiohydantoin |