2-methyl-2,4-dinitropentane structure
|
Common Name | 2-methyl-2,4-dinitropentane | ||
|---|---|---|---|---|
| CAS Number | 57704-61-7 | Molecular Weight | 176.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-2,4-dinitropentane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H12N2O4 |
|---|---|
| Molecular Weight | 176.17000 |
| Exact Mass | 176.08000 |
| PSA | 91.64000 |
| LogP | 2.14340 |
| InChIKey | IBHFLWSIQRXSEJ-UHFFFAOYSA-N |
| SMILES | CC(CC(C)(C)[N+](=O)[O-])[N+](=O)[O-] |
|
~65%
2-methyl-2,4-di... CAS#:57704-61-7 |
| Literature: W. R. Grace and Co.-Conn. Patent: US4861925 A1, 1989 ; |
|
~%
2-methyl-2,4-di... CAS#:57704-61-7 |
| Literature: Shoemaker; Keown Journal of the American Chemical Society, 1954 , vol. 76, p. 6374,6376 |
|
~%
2-methyl-2,4-di... CAS#:57704-61-7 |
| Literature: Lambert; Piggott Journal of the Chemical Society, 1947 , p. 1491 |
| 2-methyl-2,4-dinitro-pentane |
| 2-Methyl-2.4-dinitropentan |
| Pentane,2-methyl-2,4-dinitro |
| 2,4-dinitro-2-methylpentane |