2-methyl-2-[4-(2-phenylpropan-2-yl)phenoxy]propanoic acid structure
|
Common Name | 2-methyl-2-[4-(2-phenylpropan-2-yl)phenoxy]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2012-73-9 | Molecular Weight | 298.37600 | |
| Density | 1.101g/cm3 | Boiling Point | 430.7ºC at 760mmHg | |
| Molecular Formula | C19H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.7ºC | |
| Name | 2-methyl-2-[4-(2-phenylpropan-2-yl)phenoxy]propanoic acid |
|---|
| Density | 1.101g/cm3 |
|---|---|
| Boiling Point | 430.7ºC at 760mmHg |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.37600 |
| Flash Point | 149.7ºC |
| Exact Mass | 298.15700 |
| PSA | 46.53000 |
| LogP | 4.25450 |
| Vapour Pressure | 3.48E-08mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | MGQNICQOOANLCD-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1ccc(C(C)(C)c2ccccc2)cc1)C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |