Kansuinine B structure
|
Common Name | Kansuinine B | ||
|---|---|---|---|---|
| CAS Number | 57685-46-8 | Molecular Weight | 722.73200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H42O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Kansuinine BKansuinine B inhibits IL-6-induced Stat3 activation. Kansuinine B possesses anti-viral activity and could be used in the study for COVID-19[1][2][3]. |
| Name | Kansuinine B |
|---|
| Description | Kansuinine B inhibits IL-6-induced Stat3 activation. Kansuinine B possesses anti-viral activity and could be used in the study for COVID-19[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C38H42O14 |
|---|---|
| Molecular Weight | 722.73200 |
| Exact Mass | 722.25700 |
| PSA | 212.56000 |
| LogP | 1.91150 |
| InChIKey | JFOILMZFESGPDU-GXRLDEOZSA-N |
| SMILES | C=C1C(OC(=O)c2ccccc2)C(O)C(=O)C(C)(C)C2OC2C(C)C(=O)C2(OC(C)=O)C(C1OC(=O)c1ccccc1)C(OC(C)=O)C(C)(O)C2O |
| Storage condition | 2-8℃ |