2,6-Dihydroxypyrrolo(3,4-f)isoindole-1,3,5,7(2H,6H)-tetrone structure
|
Common Name | 2,6-Dihydroxypyrrolo(3,4-f)isoindole-1,3,5,7(2H,6H)-tetrone | ||
|---|---|---|---|---|
| CAS Number | 57583-53-6 | Molecular Weight | 248.14900 | |
| Density | 2.261g/cm3 | Boiling Point | 687.2ºC at 760 mmHg | |
| Molecular Formula | C10H4N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 369.4ºC | |
| Name | 2,6-dihydroxypyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 2.261g/cm3 |
|---|---|
| Boiling Point | 687.2ºC at 760 mmHg |
| Molecular Formula | C10H4N2O6 |
| Molecular Weight | 248.14900 |
| Flash Point | 369.4ºC |
| Exact Mass | 248.00700 |
| PSA | 118.60000 |
| Index of Refraction | 1.929 |
| InChIKey | VBBUVIWLZBAEEF-UHFFFAOYSA-N |
| SMILES | O=c1c2cc3c(=O)n(O)c(=O)c3cc2c(=O)n1O |
| HS Code | 2933990090 |
|---|
|
~71%
2,6-Dihydroxypy... CAS#:57583-53-6 |
| Literature: DAICEL CHEMICAL INDUSTRIES, LTD. Patent: EP1757583 A1, 2007 ; Location in patent: Page/Page column 16 ; |
|
~%
2,6-Dihydroxypy... CAS#:57583-53-6 |
| Literature: DAICEL CHEMICAL INDUSTRIES, LTD. Patent: EP1862442 A1, 2007 ; Location in patent: Page/Page column 17 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N,N'-dihydroxy-pyromellitimide |
| 2,6-dihydroxypyromellitimide |
| 2,6-Dihydroxypyrrolo[3,4-f]isoindole-1,3,5,7(2H,6H)-tetrone |
| 2,6-dihydroxybenzo[1,2-c:4,5-c']dipyrrole-1,3,5,7(2H,6H)-tetrone |
| 2,6-dihydroxypyrrolo[3,4-f]isoindolo-1,3,5,7(2H,6H)tetrone |
| N,N-dihydroxypyromelitimide |
| N,N'-dihydroxypyromellitic diimide |