4-(benzenesulfonyloxy)aniline
Modify Date: 2025-08-25 15:32:01
4-(benzenesulfonyloxy)aniline structure
|
Common Name | 4-(benzenesulfonyloxy)aniline | ||
|---|---|---|---|---|
| CAS Number | 57374-55-7 | Molecular Weight | 249.28600 | |
| Density | 1.344g/cm3 | Boiling Point | 448ºC at 760 mmHg | |
| Molecular Formula | C12H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.8ºC | |
| Name | (4-aminophenyl) benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 448ºC at 760 mmHg |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.28600 |
| Flash Point | 224.8ºC |
| Exact Mass | 249.04600 |
| PSA | 77.77000 |
| LogP | 3.69850 |
| Index of Refraction | 1.626 |
| InChIKey | JSSSSGRNRZNMKP-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OS(=O)(=O)c2ccccc2)cc1 |
|
~47%
4-(benzenesulfo... CAS#:57374-55-7 |
| Literature: Tappe, Horst Synthesis, 1980 , # 7 p. 577 - 578 |
|
~%
4-(benzenesulfo... CAS#:57374-55-7 |
| Literature: Hazlet; Dornfeld Journal of the American Chemical Society, 1944 , vol. 66, p. 1781 |
|
~%
4-(benzenesulfo... CAS#:57374-55-7 |
| Literature: Nenitzescu; Balaban Chemische Berichte, 1958 , vol. 91, p. 2109,2115 |
| 4-phenylsulphonyloxyaniline |
| 4-Amino-1-benzolsulfonyloxy-benzol |
| 4-Aminophenyl-benzolsulfonat |
| 4-aminophenyl benzenesulfonate |
| benzenesulfonic acid-(4-amino-phenyl ester) |
| Benzolsulfonsaeure-<4-amino-phenylester> |