acetic acid,[4-(10-hydroxyanthracen-9-yl)phenyl] acetate structure
|
Common Name | acetic acid,[4-(10-hydroxyanthracen-9-yl)phenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 57374-14-8 | Molecular Weight | 388.41300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,[4-(10-hydroxyanthracen-9-yl)phenyl] acetate |
|---|
| Molecular Formula | C24H20O5 |
|---|---|
| Molecular Weight | 388.41300 |
| Exact Mass | 388.13100 |
| PSA | 83.83000 |
| LogP | 5.38180 |
| InChIKey | KBALURPIGLAKRF-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(=O)Oc1ccc(-c2c3ccccc3c(O)c3ccccc23)cc1 |
|
~%
acetic acid,[4-... CAS#:57374-14-8 |
| Literature: Blicke; Warzynski Journal of the American Chemical Society, 1940 , vol. 62, p. 3191,3192 |
|
~%
acetic acid,[4-... CAS#:57374-14-8 |
| Literature: Blicke; Warzynski Journal of the American Chemical Society, 1940 , vol. 62, p. 3191,3192 |
| Precursor 4 | |
|---|---|
| DownStream 8 | |