4'-Fluoro-4-biphenylcarboxylic acid structure
|
Common Name | 4'-Fluoro-4-biphenylcarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 5731-10-2 | Molecular Weight | 216.208 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 369.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C13H9FO2 | Melting Point | 252-253ºC | |
| MSDS | Chinese USA | Flash Point | 177.2±23.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(4-Fluorophenyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 369.4±25.0 °C at 760 mmHg |
| Melting Point | 252-253ºC |
| Molecular Formula | C13H9FO2 |
| Molecular Weight | 216.208 |
| Flash Point | 177.2±23.2 °C |
| Exact Mass | 216.058655 |
| PSA | 37.30000 |
| LogP | 3.68 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | LXWNTLBMNCXRQN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccc(F)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 22-36/37/38-51/53 |
| Safety Phrases | 26-60-61 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| HS Code | 2916399090 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4'-fluorobiphenyl-4-carboxylic acid |
| 4'-Fluoro-4-biphenylcarboxylic acid |
| 4-(4-fluorophenyl)benzoic acid |
| MFCD01631909 |
| 4'-Fluoro-biphenyl-4-carboxylic acid |
| [1,1'-Biphenyl]-4-carboxylic acid, 4'-fluoro- |