N-(3,4-Dimethoxybenzyl)-2-nitroaniline structure
|
Common Name | N-(3,4-Dimethoxybenzyl)-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 5729-19-1 | Molecular Weight | 288.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3,4-Dimethoxybenzyl)-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16N2O4 |
|---|---|
| Molecular Weight | 288.29900 |
| Exact Mass | 288.11100 |
| PSA | 76.31000 |
| LogP | 3.82030 |
| InChIKey | GNUZCONTOLKVBR-UHFFFAOYSA-N |
| SMILES | COc1ccc(CNc2ccccc2[N+](=O)[O-])cc1OC |
| HS Code | 2922299090 |
|---|
|
~%
N-(3,4-Dimethox... CAS#:5729-19-1 |
| Literature: Zellner,H.; Zellner,G. Helvetica Chimica Acta, 1966 , vol. 49, p. 913 - 939 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| imi072 |