2,4-dichloro-1-(diethoxyphosphorylmethyl)benzene structure
|
Common Name | 2,4-dichloro-1-(diethoxyphosphorylmethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 57277-24-4 | Molecular Weight | 297.11500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15Cl2O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dichloro-1-(diethoxyphosphorylmethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15Cl2O3P |
|---|---|
| Molecular Weight | 297.11500 |
| Exact Mass | 296.01400 |
| PSA | 45.34000 |
| LogP | 4.75950 |
| InChIKey | LHPCNVJHBAMUPX-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(Cc1ccc(Cl)cc1Cl)OCC |
|
~93%
2,4-dichloro-1-... CAS#:57277-24-4 |
| Literature: Nasser, Jamal; About-Jaudet, Elie; Collignon, Noel Phosphorus, Sulfur and Silicon and the Related Elements, 1990 , vol. 54, # 1/4 p. 171 - 179 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| diethyl 2,4-dichlorobenzylphosphonate |