3-oxa-8,10-diazaspiro[5.5]undecane-7,9,11-trione structure
|
Common Name | 3-oxa-8,10-diazaspiro[5.5]undecane-7,9,11-trione | ||
|---|---|---|---|---|
| CAS Number | 5721-46-0 | Molecular Weight | 198.17600 | |
| Density | 1.44g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-oxa-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.17600 |
| Exact Mass | 198.06400 |
| PSA | 84.50000 |
| Index of Refraction | 1.56 |
| InChIKey | DLIFAZDYCCTKIK-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C2(CCOCC2)C(=O)N1 |
|
~%
3-oxa-8,10-diaz... CAS#:5721-46-0 |
| Literature: Kamm; Waldo Journal of the American Chemical Society, 1921 , vol. 43, p. 2225 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 9-oxa-2,4-diaza-spiro[5.5]undecane-1,3,5-trione |
| 9-Oxa-2,4-diaza-spiro[5.5]undecan-1,3,5-trion |