8,10-diazaspiro[5.5]undec-3-ene-7,9,11-trione structure
|
Common Name | 8,10-diazaspiro[5.5]undec-3-ene-7,9,11-trione | ||
|---|---|---|---|---|
| CAS Number | 18553-69-0 | Molecular Weight | 194.18700 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-diazaspiro[5.5]undec-9-ene-1,3,5-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.18700 |
| Exact Mass | 194.06900 |
| PSA | 75.27000 |
| LogP | 0.73650 |
| Index of Refraction | 1.586 |
| InChIKey | BUIPICWRVHFFRW-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C2(CC=CCC2)C(=O)N1 |
|
~%
8,10-diazaspiro... CAS#:18553-69-0 |
| Literature: Cope; Kovacic; Burg Journal of the American Chemical Society, 1949 , vol. 71, p. 3658,3659, 3662 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4-diazaspiro[5.5]undec-8-ene-1,3,5-trione |
| 2,4-Diaza-spiro[5.5]undec-8-en-1,3,5-trion |