Indoramin D5
Modify Date: 2025-10-11 00:31:30
Indoramin D5 structure
|
Common Name | Indoramin D5 | ||
|---|---|---|---|---|
| CAS Number | 57165-41-0 | Molecular Weight | 352.484 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 600.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C22H20D5N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.7±28.7 °C | |
Use of Indoramin D5Indoramin D5 is deuterium labeled Indoramin, which is a piperidine antiadrenergic agent. |
| Name | Indoramin D5 |
|---|---|
| Synonym | More Synonyms |
| Description | Indoramin D5 is deuterium labeled Indoramin, which is a piperidine antiadrenergic agent. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 600.0±45.0 °C at 760 mmHg |
| Molecular Formula | C22H20D5N3O |
| Molecular Weight | 352.484 |
| Flash Point | 316.7±28.7 °C |
| Exact Mass | 352.231140 |
| PSA | 48.13000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | JXZZEXZZKAWDSP-FSTBWYLISA-N |
| SMILES | O=C(NC1CCN(CCc2c[nH]c3ccccc23)CC1)c1ccccc1 |
| Wy-21901 D5 |
| Benzamide-d, N-[1-[2-(1H-indol-3-yl)ethyl]-4-piperidinyl]- |
| Indoramine D5 |
| N-{1-[2-(1H-Indol-3-yl)ethyl]-4-piperidinyl}(H)benzamide |
| N-(1-(2-(1H-indol-3-yl)ethyl)piperidin-4-yl)-2,3,4,5,6-pentadeuterobenzamide |