N-butyl-N-(4-methyl-1,3-oxazol-2-yl)heptanamide structure
|
Common Name | N-butyl-N-(4-methyl-1,3-oxazol-2-yl)heptanamide | ||
|---|---|---|---|---|
| CAS Number | 57068-86-7 | Molecular Weight | 266.37900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-butyl-N-(4-methyl-1,3-oxazol-2-yl)heptanamide |
|---|
| Molecular Formula | C15H26N2O2 |
|---|---|
| Molecular Weight | 266.37900 |
| Exact Mass | 266.19900 |
| PSA | 46.34000 |
| LogP | 4.08650 |
| InChIKey | VMNYHFDYZGOTKR-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)N(CCCC)c1nc(C)co1 |
|
~%
N-butyl-N-(4-me... CAS#:57068-86-7 |
| Literature: Ross; Harrison; Jolley; Neville; Todd; Verge; Dawson; Sweatman Journal of Medicinal Chemistry, 1979 , vol. 22, # 4 p. 412 - 417 |
|
~%
N-butyl-N-(4-me... CAS#:57068-86-7 |
| Literature: Ross; Harrison; Jolley; Neville; Todd; Verge; Dawson; Sweatman Journal of Medicinal Chemistry, 1979 , vol. 22, # 4 p. 412 - 417 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |