N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide
Modify Date: 2025-10-20 18:32:57
N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide structure
|
Common Name | N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 57067-79-5 | Molecular Weight | 222.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide |
|---|
| Molecular Formula | C12H18N2O2 |
|---|---|
| Molecular Weight | 222.28400 |
| Exact Mass | 222.13700 |
| PSA | 46.34000 |
| LogP | 2.52610 |
| InChIKey | YSKPHODLBKBYJO-UHFFFAOYSA-N |
| SMILES | CCCCN(C(=O)C1CC1)c1nc(C)co1 |
|
~%
N-butyl-N-(4-me... CAS#:57067-79-5 |
| Literature: Ross; Harrison; Jolley; Neville; Todd; Verge; Dawson; Sweatman Journal of Medicinal Chemistry, 1979 , vol. 22, # 4 p. 412 - 417 |
|
~%
N-butyl-N-(4-me... CAS#:57067-79-5 |
| Literature: Ross; Harrison; Jolley; Neville; Todd; Verge; Dawson; Sweatman Journal of Medicinal Chemistry, 1979 , vol. 22, # 4 p. 412 - 417 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |