4-[3-(4-hydroxyphenyl)hexyl]phenol
Modify Date: 2025-11-25 18:53:16
![4-[3-(4-hydroxyphenyl)hexyl]phenol Structure](https://image.chemsrc.com/caspic/131/5702-89-6.png)
4-[3-(4-hydroxyphenyl)hexyl]phenol structure
|
Common Name | 4-[3-(4-hydroxyphenyl)hexyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 5702-89-6 | Molecular Weight | 270.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[3-(4-hydroxyphenyl)hexyl]phenol |
|---|
| Molecular Formula | C18H22O2 |
|---|---|
| Molecular Weight | 270.36600 |
| Exact Mass | 270.16200 |
| PSA | 40.46000 |
| LogP | 4.61430 |
| InChIKey | KBDAGKROQKTLLM-UHFFFAOYSA-N |
| SMILES | CCCC(CCc1ccc(O)cc1)c1ccc(O)cc1 |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |