(4-bromo-2-phenyl-phenyl) acetate structure
|
Common Name | (4-bromo-2-phenyl-phenyl) acetate | ||
|---|---|---|---|---|
| CAS Number | 57018-28-7 | Molecular Weight | 291.14000 | |
| Density | 1.396g/cm3 | Boiling Point | 375.1ºC at 760 mmHg | |
| Molecular Formula | C14H11BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.7ºC | |
| Name | (4-bromo-2-phenylphenyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.396g/cm3 |
|---|---|
| Boiling Point | 375.1ºC at 760 mmHg |
| Molecular Formula | C14H11BrO2 |
| Molecular Weight | 291.14000 |
| Flash Point | 180.7ºC |
| Exact Mass | 289.99400 |
| PSA | 26.30000 |
| LogP | 4.04140 |
| Index of Refraction | 1.584 |
| InChIKey | LYMRDTZAQQTELS-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(Br)cc1-c1ccccc1 |
|
~%
(4-bromo-2-phen... CAS#:57018-28-7 |
| Literature: Hazlet; Kornberg Journal of the American Chemical Society, 1941 , vol. 63, p. 1890 |
|
~%
(4-bromo-2-phen... CAS#:57018-28-7 |
| Literature: Hazlet; Kornberg Journal of the American Chemical Society, 1941 , vol. 63, p. 1890 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-bromobiphenyl-2-yl acetate |
| 5-Brom-2-acetoxy-biphenyl |