4-Hexylsulfonyl-2,3,5,6-tetrachlorobenzonitrile structure
|
Common Name | 4-Hexylsulfonyl-2,3,5,6-tetrachlorobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 56916-68-8 | Molecular Weight | 389.12500 | |
| Density | 1.48g/cm3 | Boiling Point | 520.9ºC at 760 mmHg | |
| Molecular Formula | C13H13Cl4NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.8ºC | |
| Name | 2,3,5,6-tetrachloro-4-hexylsulfonylbenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 520.9ºC at 760 mmHg |
| Molecular Formula | C13H13Cl4NO2S |
| Molecular Weight | 389.12500 |
| Flash Point | 268.8ºC |
| Exact Mass | 386.94200 |
| PSA | 66.31000 |
| LogP | 6.60668 |
| Index of Refraction | 1.58 |
| InChIKey | RRYNAQHVYUEIAX-UHFFFAOYSA-N |
| SMILES | CCCCCCS(=O)(=O)c1c(Cl)c(Cl)c(C#N)c(Cl)c1Cl |
|
~%
4-Hexylsulfonyl... CAS#:56916-68-8 |
| Literature: Heilman; Battershell; Pyne; Goble; Magee Journal of Medicinal Chemistry, 1978 , vol. 21, # 9 p. 906 - 913 |
|
~%
4-Hexylsulfonyl... CAS#:56916-68-8 |
| Literature: Heilman; Battershell; Pyne; Goble; Magee Journal of Medicinal Chemistry, 1978 , vol. 21, # 9 p. 906 - 913 |
| 4-Hexylsulfonyl-2,3,5,6-tetrachlorobenzonitrile |
| BENZONITRILE,4-HEXYLSULFONYL-2,3,5,6-TETRACHLORO |