4-Pentylsulfonyl-2,3,5,6-tetrachlorobenzonitrile structure
|
Common Name | 4-Pentylsulfonyl-2,3,5,6-tetrachlorobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 56916-64-4 | Molecular Weight | 375.09800 | |
| Density | 1.52g/cm3 | Boiling Point | 512.4ºC at 760 mmHg | |
| Molecular Formula | C12H11Cl4NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.7ºC | |
| Name | 2,3,5,6-tetrachloro-4-pentylsulfonylbenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 512.4ºC at 760 mmHg |
| Molecular Formula | C12H11Cl4NO2S |
| Molecular Weight | 375.09800 |
| Flash Point | 263.7ºC |
| Exact Mass | 372.92600 |
| PSA | 66.31000 |
| LogP | 6.21658 |
| Index of Refraction | 1.587 |
| InChIKey | QIWWTBJLBOJJSB-UHFFFAOYSA-N |
| SMILES | CCCCCS(=O)(=O)c1c(Cl)c(Cl)c(C#N)c(Cl)c1Cl |
|
~%
4-Pentylsulfony... CAS#:56916-64-4 |
| Literature: Heilman; Battershell; Pyne; Goble; Magee Journal of Medicinal Chemistry, 1978 , vol. 21, # 9 p. 906 - 913 |
|
~%
4-Pentylsulfony... CAS#:56916-64-4 |
| Literature: Heilman; Battershell; Pyne; Goble; Magee Journal of Medicinal Chemistry, 1978 , vol. 21, # 9 p. 906 - 913 |
| BENZONITRILE,4-PENTYLSULFONYL-2,3,5,6-TETRACHLORO |
| 4-Pentylsulfonyl-2,3,5,6-tetrachlorobenzonitrile |