2,3,5,6-Tetrahydro-5-(4-methoxyphenyl)imidazo[2,1-a]isoquinolin-5-ol structure
|
Common Name | 2,3,5,6-Tetrahydro-5-(4-methoxyphenyl)imidazo[2,1-a]isoquinolin-5-ol | ||
|---|---|---|---|---|
| CAS Number | 56882-47-4 | Molecular Weight | 294.34800 | |
| Density | 1.26g/cm3 | Boiling Point | 472ºC at 760 mmHg | |
| Molecular Formula | C18H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.3ºC | |
| Name | 5-(4-methoxyphenyl)-3,6-dihydro-2H-imidazo[2,1-a]isoquinolin-5-ol |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 472ºC at 760 mmHg |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.34800 |
| Flash Point | 239.3ºC |
| Exact Mass | 294.13700 |
| PSA | 45.06000 |
| LogP | 1.53230 |
| Index of Refraction | 1.652 |
| InChIKey | JAHZSXVGNHTXMR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(O)Cc3ccccc3C3=NCCN32)cc1 |
|
~%
2,3,5,6-Tetrahy... CAS#:56882-47-4 |
| Literature: Houlihan; Gogerty; Parrino; Ryan Journal of Medicinal Chemistry, 1983 , vol. 26, # 5 p. 765 - 768 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |