2-bromobenzylmagnesium bromide structure
|
Common Name | 2-bromobenzylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 56812-60-3 | Molecular Weight | 274.23600 | |
| Density | 0.770 g/mL at 25ºC | Boiling Point | 34.6ºC | |
| Molecular Formula | C7H6Br2Mg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | magnesium,1-bromo-2-methanidylbenzene,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.770 g/mL at 25ºC |
|---|---|
| Boiling Point | 34.6ºC |
| Molecular Formula | C7H6Br2Mg |
| Molecular Weight | 274.23600 |
| Flash Point | 1 °F |
| Exact Mass | 271.86900 |
| LogP | 3.61040 |
| Appearance of Characters | Solution | Clear yellow to brown |
| InChIKey | XGAWDDBPRRNVDO-UHFFFAOYSA-M |
| SMILES | [Br-].[CH2-]c1ccccc1Br.[Mg+2] |
| Storage condition | 2-8°C |
| Hazard Codes | F+,C |
|---|---|
| Risk Phrases | 12-14-19-22-34-66-67 |
| Safety Phrases | 16-26-33-36/37/39-45 |
| RIDADR | UN 2924 3/PG 1 |
| WGK Germany | 1 |
|
~0%
2-bromobenzylma... CAS#:56812-60-3 |
| Literature: Gallagher, Michael J.; Harvey, Stephen; Raston, Colin L.; Sue, Rodney E. Journal of the Chemical Society, Chemical Communications, 1988 , # 4 p. 289 - 290 |
|
~%
2-bromobenzylma... CAS#:56812-60-3 |
| Literature: Journal of Organometallic Chemistry, , vol. 321, p. 291 - 306 |
| o-BrC6H4CH2MgBr |
| 2-Bromobenzylmagnesium bromide 0.25 M in Diethyl Ether |
| MFCD01319903 |
| o-Brom-benzylmagnesiumbromid |
| 2-Bromobenzylmagnesium bromide solution |
| 2-bromobenzylamagnesium bromide |