3,4-Dichloro-5-nitropyridine
Modify Date: 2025-08-25 19:42:22
3,4-Dichloro-5-nitropyridine structure
|
Common Name | 3,4-Dichloro-5-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 56809-84-8 | Molecular Weight | 192.98800 | |
| Density | 1.63g/cm3 | Boiling Point | 258.751ºC at 760 mmHg | |
| Molecular Formula | C5H2Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.289ºC | |
| Name | 3,4-Dichloro-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 258.751ºC at 760 mmHg |
| Molecular Formula | C5H2Cl2N2O2 |
| Molecular Weight | 192.98800 |
| Flash Point | 110.289ºC |
| Exact Mass | 191.94900 |
| PSA | 58.71000 |
| LogP | 2.81980 |
| Index of Refraction | 1.603 |
| InChIKey | LSVPLFVLCXIYHM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cncc(Cl)c1Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
![7-chlorothiazolo[4,5-c]pyridine-2-thiol structure](https://image.chemsrc.com/caspic/034/908355-84-0.png)
CAS#:908355-84-0
CAS#:89284-28-6
CAS#:89284-39-9| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Nitro-4,5-dichlorpyridin |
| 3,4-dichloro-5-nitro-pyridine |
| Pyridine,3,4-dichloro-5-nitro |
| 3,4-Dichloro-5-nitro-pyridin |