[4-[Bis(2-hydroxyethyl)amino]phenyl]-1,1,2-ethylenetricarbonitrile
Modify Date: 2025-08-27 10:17:49
![[4-[Bis(2-hydroxyethyl)amino]phenyl]-1,1,2-ethylenetricarbonitrile Structure](https://image.chemsrc.com/caspic/028/56672-91-4.png)
[4-[Bis(2-hydroxyethyl)amino]phenyl]-1,1,2-ethylenetricarbonitrile structure
|
Common Name | [4-[Bis(2-hydroxyethyl)amino]phenyl]-1,1,2-ethylenetricarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 56672-91-4 | Molecular Weight | 282.29700 | |
| Density | 1.326g/cm3 | Boiling Point | 518.4ºC at 760 mmHg | |
| Molecular Formula | C15H14N4O2 | Melting Point | 72-76ºC(lit.) | |
| MSDS | USA | Flash Point | 267.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethene-1,1,2-tricarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 518.4ºC at 760 mmHg |
| Melting Point | 72-76ºC(lit.) |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.29700 |
| Flash Point | 267.3ºC |
| Exact Mass | 282.11200 |
| PSA | 115.07000 |
| LogP | 0.80194 |
| Index of Refraction | 1.636 |
| InChIKey | XIKHTCQHDCGMQI-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)=C(C#N)c1ccc(N(CCO)CCO)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
|
~94%
[4-[Bis(2-hydro... CAS#:56672-91-4 |
| Literature: Deligeorgiev, Todor; Lesev, Nedyalko; Kaloyanova, Stefka Dyes and Pigments, 2011 , vol. 91, # 1 p. 74 - 78 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| I05-2988 |
| [4-[Bis(2-hydroxyethyl)amino]phenyl]-1,1,2-ethylenetricarbonitrile |
| MFCD04039916 |