WFP6MAA96R structure
|
Common Name | WFP6MAA96R | ||
|---|---|---|---|---|
| CAS Number | 56343-01-2 | Molecular Weight | 262.148 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4Na2O6S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | WFP6MAA96R |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4Na2O6S |
|---|---|
| Molecular Weight | 262.148 |
| Exact Mass | 261.952393 |
| InChIKey | MHLQQQGNMJCVEB-UHFFFAOYSA-L |
| SMILES | O=C([O-])c1ccccc1OS(=O)(=O)[O-].[Na+].[Na+] |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
|
A stress-inducible sulphotransferase sulphonates salicylic acid and confers pathogen resistance in Arabidopsis.
Plant Cell Environ. 33(8) , 1383-92, (2010) Sulphonation of small molecules by cytosolic sulphotransferases in mammals is an important process in which endogenous molecules are modified for inactivation/activation of their biological effects. P... |
| Disodium 2-hydroxy-5-sulfonatobenzoate |
| WFP6MAA96R |
| Benzoic acid, 2-hydroxy-5-sulfo-, sodium salt (1:2) |
| DISODIUM SULFOSALICYLATE |