N-[2-(2,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide structure
|
Common Name | N-[2-(2,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5623-25-6 | Molecular Weight | 364.43600 | |
| Density | 1.173g/cm3 | Boiling Point | 569.2ºC at 760 mmHg | |
| Molecular Formula | C26H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.8ºC | |
| Name | 2-hydroxy-1,2-bis(4-phenylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 569.2ºC at 760 mmHg |
| Molecular Formula | C26H20O2 |
| Molecular Weight | 364.43600 |
| Flash Point | 238.8ºC |
| Exact Mass | 364.14600 |
| PSA | 37.30000 |
| LogP | 5.93690 |
| Index of Refraction | 1.637 |
| InChIKey | MGUZTXXISNAEDO-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)C(O)c1ccc(-c2ccccc2)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2914400090 |
|---|
|
~82%
N-[2-(2,4-dimet... CAS#:5623-25-6 |
| Literature: Bag, Seema; Vaze, Vidula V.; Degani, Mariam S. Journal of Chemical Research, 2006 , # 4 p. 267 - 269 |
|
~%
N-[2-(2,4-dimet... CAS#:5623-25-6 |
| Literature: Bachmann Journal of the American Chemical Society, 1934 , vol. 56, p. 963 |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1.2-Bis-diphenylyl-aethanolon |
| 1,2-di-1,1'-biphenyl-4-yl-2-hydroxyethanone |
| 4,4'-diphenylbenzoin |