Methyl lycernuate A
Modify Date: 2025-09-19 18:16:25
Methyl lycernuate A structure
|
Common Name | Methyl lycernuate A | ||
|---|---|---|---|---|
| CAS Number | 56218-46-3 | Molecular Weight | 486.726 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 565.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C31H50O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.7±23.6 °C | |
| Name | L-Tyrosine,N-methyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 565.7±50.0 °C at 760 mmHg |
| Molecular Formula | C31H50O4 |
| Molecular Weight | 486.726 |
| Flash Point | 172.7±23.6 °C |
| Exact Mass | 486.370911 |
| PSA | 66.76000 |
| LogP | 7.93 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | YJCLBMDGUOAHFA-BUWPLOKVSA-N |
| SMILES | COC(=O)C1(C)C(O)CCC2(C)C3CCC4C(=CCC5C(C)(C)C(O)CCC45C)CC3(C)CCC21 |
| Hazard Codes | Xi |
|---|
|
~%
Methyl lycernuate A CAS#:56218-46-3 |
| Literature: Tsuda; Isobe; Sano Chemical and Pharmaceutical Bulletin, 1975 , vol. 23, # 2 p. 264 - 271 |
| andirine |
| 1H-Cyclohepta[1,2-a:5,4-a']dinaphthalene-4-carboxylic acid, 2,3,4,4a,5,6,6a,7,9,9a,10,11,12,13,13a,13b,14,15,15a,15b-eicosahydro-3,11-dihydroxy-4,6a,10,10,13a,15b-hexamethyl-, methyl ester, (3S,4R,4aR,6aS,9aR,11R,13aR,13bS,15aS,15bR)- |
| Methyl (3S,4R,4aR,6aS,9aR,11R,13aR,13bS,15aS,15bR)-3,11-dihydroxy-4,6a,10,10,13a,15b-hexamethyl-2,3,4,4a,5,6,6a,7,9,9a,10,11,12,13,13a,13b,14,15,15a,15b-icosahydro-1H-naphtho[2',1':4,5]cyclohepta[1,2-a]naphthalene-4-carboxylate |
| Andrine |
| Surinamine |
| Methyllycerniat-A |
| methyl-L-tyrosine |
| N-methyl-L-tyrosine |
| L-N-methyltyrosine |
| N-Me-Tyr-OH |