Cefazedone structure
|
Common Name | Cefazedone | ||
|---|---|---|---|---|
| CAS Number | 56187-47-4 | Molecular Weight | 548.443 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H15Cl2N5O5S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CefazedoneCefazedone (Refosporen) is a first-generation cephalosporin with activity against Gram-positive and Gram-negative bacteria, and it is effective in the treatment of infections caused by sensitive bacteria. Cefazedone is a time-dependent antibiotic, the time of concentration exceeds the minimum inhibitory concentration (MIC) is the key pharmacokinetic-pharmacodynamic (PK-PD) variable associated with the killing of pathogens[1]. |
| Name | (6R,7R)-7-[[2-(3,5-dichloro-4-oxopyridin-1-yl)acetyl]amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Cefazedone (Refosporen) is a first-generation cephalosporin with activity against Gram-positive and Gram-negative bacteria, and it is effective in the treatment of infections caused by sensitive bacteria. Cefazedone is a time-dependent antibiotic, the time of concentration exceeds the minimum inhibitory concentration (MIC) is the key pharmacokinetic-pharmacodynamic (PK-PD) variable associated with the killing of pathogens[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Molecular Formula | C18H15Cl2N5O5S3 |
| Molecular Weight | 548.443 |
| Exact Mass | 546.961243 |
| PSA | 213.33000 |
| LogP | 0.92 |
| Index of Refraction | 1.761 |
| InChIKey | VTLCNEGVSVJLDN-MLGOLLRUSA-N |
| SMILES | Cc1nnc(SCC2=C(C(=O)O)N3C(=O)C(NC(=O)Cn4cc(Cl)c(=O)c(Cl)c4)C3SC2)s1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
~%
Cefazedone CAS#:56187-47-4 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 29, # 2 A p. 362 - 369 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Cefazedonum |
| Refosporen |
| Cefazedone [INN:BAN] |
| Cefazedonum [INN-Latin] |
| 3-(5-Methyl-1,3,4-thiadiazolyl-2-mercaptomethyl)-7-(3,5-dichloro-4-pyridon-1-ylacetamido)-3-cephem-4-carboxylic Acid |
| (6R,7R)-7-{[(3,5-Dichloro-4-oxopyridin-1(4H)-yl)acetyl]amino}-3-{[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Cefazedone |
| (6R,7R)-7-{[(3,5-Dichloro-4-oxo-1(4H)-pyridinyl)acetyl]amino}-3-{[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| (6R)-7t-[2-(3,5-dichloro-4-oxo-4H-pyridin-1-yl)-acetylamino]-3-(5-methyl-[1,3,4]thiadiazol-2-ylsulfanylmethyl)-8-oxo-(6rH)-5-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[2-(3,5-dichloro-4-oxo-1(4H)-pyridinyl)acetyl]amino]-3-[[(5-methyl-1,3,4-thiadiazol-2-yl)thio]methyl]-8-oxo-, (6R,7R)- |
| MFCD01682029 |
| Cefazedona |
| Refosporene |
| Cefazedona [INN-Spanish] |