di-tert-butylChlorophosphate
Modify Date: 2025-08-25 18:17:24
di-tert-butylChlorophosphate structure
|
Common Name | di-tert-butylChlorophosphate | ||
|---|---|---|---|---|
| CAS Number | 56119-60-9 | Molecular Weight | 228.65300 | |
| Density | 1.094g/cm3 | Boiling Point | 256.871ºC at 760 mmHg | |
| Molecular Formula | C8H18ClO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.298ºC | |
| Name | di-tert-butylChlorophosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.094g/cm3 |
|---|---|
| Boiling Point | 256.871ºC at 760 mmHg |
| Molecular Formula | C8H18ClO3P |
| Molecular Weight | 228.65300 |
| Flash Point | 118.298ºC |
| Exact Mass | 228.06800 |
| PSA | 45.34000 |
| LogP | 3.96350 |
| Index of Refraction | 1.433 |
| InChIKey | OWXJRBHLTRSSIT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OP(=O)(Cl)OC(C)(C)C |
|
~74%
di-tert-butylCh... CAS#:56119-60-9 |
| Literature: PFIZER INC.; BROWN, Matthew Frank; DONOVAN, Charles Francis; ELLSWORTH, Edmund Lee; HOYER, Denton Wade; JOHNSON, Timothy Allen; LALL, Manjinder Singh; LIMBERAKIS, Chris; MURPHY, Sean Timothy; SHERRY, Debra Ann; TAYLOR, Clarke Bentley; WARMUS, Joseph Scott Patent: WO2010/32147 A2, 2010 ; Location in patent: Page/Page column 84 ; WO 2010/032147 A2 |
|
~%
di-tert-butylCh... CAS#:56119-60-9 |
| Literature: Goldwhite; Saunders Journal of the Chemical Society, 1957 , p. 2409,2412 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![2-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]phenol structure](https://image.chemsrc.com/caspic/481/98057-61-5.png)
CAS#:98057-61-5| chlorophosphoric acid di-tert-butyl ester |
| Chlorophosphorsaeure-di-tert-butylester |
| Diethyl phosphorochloride |
| chlorophosphonic acid diethyl ester |
| O,O-diethyl phosphorochloridate |
| diethyl chlorophosphate |
| O,O-Diethyl chlorophosphate |
| Di-tert-butyl-chlorophosphat |
| di-tert-butylphosphorochloridate |
| Diethyl chlorophosphonate |
| Diethoxyphosphorus oxychloride |
| ditert.-butylphosphoric acid chloride |
| Diethoxyphosphoryl chloride |
| Diethyl phosphorochloridate |
| phosphorochloridic acid di-tert-butyl ester |
| O,O-diethylphosphoryl chloride |
| O,O-Diethyl chloridophosphate |
| Phosphorochloridic acid,diethyl ester |
| di-tert-butyl phosphochloridate |