gibberellin A5 structure
|
Common Name | gibberellin A5 | ||
|---|---|---|---|---|
| CAS Number | 561-56-8 | Molecular Weight | 330.375 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 573.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.3±23.6 °C | |
Use of gibberellin A5Gibberellin A5 is a plant hormone that promotes floral development [1]. |
| Name | gibberellin A5 |
|---|---|
| Synonym | More Synonyms |
| Description | Gibberellin A5 is a plant hormone that promotes floral development [1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 573.8±50.0 °C at 760 mmHg |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.375 |
| Flash Point | 211.3±23.6 °C |
| Exact Mass | 330.146729 |
| PSA | 83.83000 |
| LogP | 0.95 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Index of Refraction | 1.640 |
| InChIKey | ZOWHLBOPCIHIHW-LUGKBOQRSA-N |
| SMILES | C=C1CC23CC1(O)CCC2C12CC=CC(C)(C(=O)O1)C2C3C(=O)O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 4a,1-(Epoxymethano)-7,9a-methanobenz[a]azulene-10-carboxylic acid, 1,4,4b,5,6,7,8,9,10,10a-decahydro-7-hydroxy-1-methyl-8-methylene-13-oxo-, (4aR,4bR,7S,9aS,10S,10aR)- |
| (1R,2R,5S,8S,9S,10R)-5-Hydroxy-11-methyl-6-methylene-16-oxo-15-oxapentacyclo[9.3.2.1.0.0]heptadec-12-ene-9-carboxylic acid |
| (1R,4aR,4bR,7S,9aS,10S,10aR)-7-hydroxy-1-methyl-8-methylidene-13-oxo-1,4,4b,5,6,7,8,9,10,10a-decahydro-4a,1-(epoxymethano)-7,9a-methanobenzo[a]azulene-10-carboxylic acid |
| gibberellin A5 |