1-(4-methoxyphenyl)ethenoxy-trimethylsilane structure
|
Common Name | 1-(4-methoxyphenyl)ethenoxy-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 55991-65-6 | Molecular Weight | 222.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methoxyphenyl)ethenoxy-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18O2Si |
|---|---|
| Molecular Weight | 222.35600 |
| Exact Mass | 222.10800 |
| PSA | 18.46000 |
| LogP | 3.51740 |
| InChIKey | DETSSEMLCSSBPS-UHFFFAOYSA-N |
| SMILES | C=C(O[Si](C)(C)C)c1ccc(OC)cc1 |
|
~78%
1-(4-methoxyphe... CAS#:55991-65-6 |
| Literature: FERRER INTERNACIONAL, S.A. Patent: EP1707558 A1, 2006 ; Location in patent: Page/Page column 14 ; |
|
~60%
1-(4-methoxyphe... CAS#:55991-65-6 |
| Literature: O'Neill; Pugh; Stachulski; Ward; Davies; Kevin Park Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 20 p. 2682 - 2689 |
|
~%
1-(4-methoxyphe... CAS#:55991-65-6 |
| Literature: Saalfrank, Rolf W.; Guendel, Juergen; Rossmann, Guenther; Hanek, Martin; Rost, Walter; et al. Chemische Berichte, 1990 , vol. 123, # 5 p. 1175 - 1183 |
| Precursor 3 | |
|---|---|
| DownStream 9 | |
| p-methoxyacetophenone trimethylsilyl enol ether |
| 1-trimethylsilyloxy 4'-methoxystyrene |
| 4-methoxyacetophenone trimethylsilylenol |