Butaverine structure
|
Common Name | Butaverine | ||
|---|---|---|---|---|
| CAS Number | 55837-14-4 | Molecular Weight | 289.41200 | |
| Density | 1.036g/cm3 | Boiling Point | 390.6ºC at 760 mmHg | |
| Molecular Formula | C18H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.1ºC | |
| Name | Butaverine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.036g/cm3 |
|---|---|
| Boiling Point | 390.6ºC at 760 mmHg |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.41200 |
| Flash Point | 125.1ºC |
| Exact Mass | 289.20400 |
| PSA | 29.54000 |
| LogP | 3.88490 |
| Index of Refraction | 1.523 |
| InChIKey | WQDZHQZKJMNOAY-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CC(c1ccccc1)N1CCCCC1 |
|
~72%
Butaverine CAS#:55837-14-4 |
| Literature: Hatano, Bunpei; Nagahashi, Keita; Kijima, Tatsuro Journal of Organic Chemistry, 2008 , vol. 73, # 22 p. 9188 - 9191 |
|
~%
Butaverine CAS#:55837-14-4 |
| Literature: Pollard; Mattson Journal of the American Chemical Society, 1956 , vol. 78, p. 4089 |
|
~%
Butaverine CAS#:55837-14-4 |
| Literature: Pollard; Mattson Journal of the American Chemical Society, 1956 , vol. 78, p. 4089 |
| 3-Phenyl-3-(1-piperidyl)propionic acid butyl ester |
| 3-Piperidino-3-phenyl-propionsaeure-butylester |
| ethyl 3-phenyl-3-piperidinopropanoate |
| 3-phenyl-3-piperidino-propionic acid butyl ester |
| 3-Phenyl-3-piperidino-propionsaeure-butylester |