3-(4-chlorophenyl)-1-(5-methyloxazol-3-yl)urea structure
|
Common Name | 3-(4-chlorophenyl)-1-(5-methyloxazol-3-yl)urea | ||
|---|---|---|---|---|
| CAS Number | 55807-83-5 | Molecular Weight | 251.66900 | |
| Density | 1.445g/cm3 | Boiling Point | 311ºC at 760 mmHg | |
| Molecular Formula | C11H10ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.9ºC | |
| Name | 1-(4-chlorophenyl)-3-(5-methylisoxazol-3-yl)urea |
|---|
| Density | 1.445g/cm3 |
|---|---|
| Boiling Point | 311ºC at 760 mmHg |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.66900 |
| Flash Point | 141.9ºC |
| Exact Mass | 251.04600 |
| PSA | 67.16000 |
| LogP | 3.42640 |
| Index of Refraction | 1.671 |
| InChIKey | DXYFEDVLADECTN-UHFFFAOYSA-N |
| SMILES | CC1=CN(NC(=O)Nc2ccc(Cl)cc2)CO1 |
|
~%
3-(4-chlorophen... CAS#:55807-83-5 |
| Literature: Rajanarendar; Ramu; Srinivas Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 8 p. 1784 - 1786 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |