2,6-dimethoxy-3-nitrobenzoic acid structure
|
Common Name | 2,6-dimethoxy-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 55776-17-5 | Molecular Weight | 227.17100 | |
| Density | 1.403 g/cm3 | Boiling Point | 420.7ºC at 760 mmHg | |
| Molecular Formula | C9H9NO6 | Melting Point | 130-132ºC | |
| MSDS | N/A | Flash Point | 208.2ºC | |
| Name | 2,6-dimethoxy-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.403 g/cm3 |
|---|---|
| Boiling Point | 420.7ºC at 760 mmHg |
| Melting Point | 130-132ºC |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.17100 |
| Flash Point | 208.2ºC |
| Exact Mass | 227.04300 |
| PSA | 101.58000 |
| LogP | 1.83340 |
| Index of Refraction | 1.569 |
| InChIKey | YIKBQFPTPKEFSM-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(OC)c1C(=O)O |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,5-DIHYDROXY-3-PENTYL-[1,4]BENZOQUINONE |
| 2,6-dimethoxy-3-nitro-benzoic acid |
| EINECS 259-814-1 |
| MFCD00017324 |