1-[4-(4-nitrophenyl)sulfonyloxyphenyl]ethanone structure
|
Common Name | 1-[4-(4-nitrophenyl)sulfonyloxyphenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 55660-68-9 | Molecular Weight | 321.30500 | |
| Density | 1.418g/cm3 | Boiling Point | 529ºC at 760 mmHg | |
| Molecular Formula | C14H11NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.7ºC | |
| Name | 4-acetylphenyl 4-nitrobenzenesulfonate |
|---|
| Density | 1.418g/cm3 |
|---|---|
| Boiling Point | 529ºC at 760 mmHg |
| Molecular Formula | C14H11NO6S |
| Molecular Weight | 321.30500 |
| Flash Point | 273.7ºC |
| Exact Mass | 321.03100 |
| PSA | 114.64000 |
| LogP | 4.16910 |
| Index of Refraction | 1.599 |
| InChIKey | LVHCZMCBHGZLLI-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
1-[4-(4-nitroph... CAS#:55660-68-9 |
| Literature: Yarishkin, Oleg V.; Ryu, Hyung Won; Park, Jae-Yong; Yang, Min Suk; Hong, Seong-Geun; Park, Ki Hun Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 1 p. 137 - 140 |
|
~%
1-[4-(4-nitroph... CAS#:55660-68-9 |
| Literature: D'Rozario, Peter; Smyth, Richard L.; Williams, Andrew Journal of the American Chemical Society, 1984 , vol. 106, # 17 p. 5027 - 5028 |