Sulfuric acid,monopentyl ester, sodium salt (1:1) structure
|
Common Name | Sulfuric acid,monopentyl ester, sodium salt (1:1) | ||
|---|---|---|---|---|
| CAS Number | 556-76-3 | Molecular Weight | 190.19300 | |
| Density | 1.03 g/mL at 20ºC | Boiling Point | N/A | |
| Molecular Formula | C5H11NaO4S | Melting Point | 204-207ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium dodecyl sulfate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03 g/mL at 20ºC |
|---|---|
| Melting Point | 204-207ºC(lit.) |
| Molecular Formula | C5H11NaO4S |
| Molecular Weight | 190.19300 |
| Exact Mass | 190.02800 |
| PSA | 74.81000 |
| LogP | 1.73420 |
| InChIKey | KLZYTGLGWPHIDV-UHFFFAOYSA-M |
| SMILES | CCCCCOS(=O)(=O)[O-].[Na+] |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | UN 2926 4 |
| HS Code | 2920909090 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00041882 |
| EINECS 209-140-9 |
| Sodium pentyl sulphate |