N-(3-acetamidophenyl)-3-methoxybenzamide structure
|
Common Name | N-(3-acetamidophenyl)-3-methoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 5553-74-2 | Molecular Weight | 284.31000 | |
| Density | 1.261g/cm3 | Boiling Point | 436.8ºC at 760 mmHg | |
| Molecular Formula | C16H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218ºC | |
| Name | N-(3-acetamidophenyl)-3-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 436.8ºC at 760 mmHg |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31000 |
| Flash Point | 218ºC |
| Exact Mass | 284.11600 |
| PSA | 74.41000 |
| LogP | 3.93940 |
| Index of Refraction | 1.645 |
| InChIKey | MGHQMJCQZTVVCT-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)Nc2cccc(NC(C)=O)c2)c1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(3-acetamidop... CAS#:5553-74-2 |
| Literature: Berger, Ludwig Patent: US3245878 , 1966 ; Chem.Abstr., 1966 , vol. 64, # 19504 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(3-ACETAMIDOPHENYL)-3-METHOXY-BENZAMIDE |
| N-[3-(acetylamino)phenyl]-3-methoxybenzamide |
| O-(2-Methyl-benzyl)-N-benzyl-N-acetyl-hydroxylamin |