4-[METHYL(PHENYL)AMINO]BENZALDEHYDE structure
|
Common Name | 4-[METHYL(PHENYL)AMINO]BENZALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 55489-38-8 | Molecular Weight | 211.25900 | |
| Density | 1.137g/cm3 | Boiling Point | 369.6ºC at 760 mmHg | |
| Molecular Formula | C14H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147ºC | |
| Name | 4-(N-methylanilino)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 369.6ºC at 760 mmHg |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.25900 |
| Flash Point | 147ºC |
| Exact Mass | 211.10000 |
| PSA | 20.31000 |
| LogP | 3.26700 |
| Index of Refraction | 1.642 |
| InChIKey | GDKRKWOVNXZJRF-UHFFFAOYSA-N |
| SMILES | CN(c1ccccc1)c1ccc(C=O)cc1 |
| HS Code | 2922399090 |
|---|
|
~30%
4-[METHYL(PHENY... CAS#:55489-38-8 |
| Literature: Bhojgude, Sachin Suresh; Kaicharla, Trinadh; Biju, Akkattu T. Organic Letters, 2013 , vol. 15, # 21 p. 5452 - 5455 |
|
~%
4-[METHYL(PHENY... CAS#:55489-38-8 |
| Literature: Geigy and Co. Patent: DE103578 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-(N-methyl-anilino)-benzaldehyde |
| 4-(N-Methyl-anilino)-benzaldehyd |
| 4-(Methyl-phenylamino)-benzaldehyd |
| Benzaldehyde,4-(methylphenylamino) |
| 4-[methyl(phenyl)amino]benzaldehyde |