Desacetylcephalothin sodium
Modify Date: 2025-11-25 15:39:27
Desacetylcephalothin sodium structure
|
Common Name | Desacetylcephalothin sodium | ||
|---|---|---|---|---|
| CAS Number | 5547-29-5 | Molecular Weight | 376.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13N2NaO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Desacetylcephalothin sodiumDeacetylcephalothin Sodium Salt, is an impurity in the synthesis of Cefalonium (C236800) and an analog of Cephalothin (C261150) a first-generation cephalosporin antibiotic used as a long-acting intramammary cerate for infusion of dairy cows. |
| Name | sodium,(6R,7R)-3-(hydroxymethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13N2NaO5S2 |
|---|---|
| Molecular Weight | 376.38300 |
| Exact Mass | 376.01600 |
| PSA | 166.80000 |
| LogP | 0.67220 |
| InChIKey | UBZLUULXMJGRPG-UHFFFAOYSA-M |
| SMILES | O=C(Cc1cccs1)NC1C(=O)N2C(C(=O)[O-])=C(CO)CSC12.[Na+] |
| Deacetylcephalothin sodium salt |
| 7-(Thiophene-2-acetamide)cephalosporanate sodium |
| Desacetylcephalothin sodium |
| Dacet |
| 5-Thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylic acid,3-(hydroxymethyl)-8-oxo-7-(2-(2-thienyl)acetamido)-,sodium salt |