(3Z)-3-[[2-(1,1-Dimethyl-2-propenyl)-6-(3-methyl-2-butenyl)-1H-indol-3-yl]methylene]-6-methylene-2,5-piperazinedione structure
|
Common Name | (3Z)-3-[[2-(1,1-Dimethyl-2-propenyl)-6-(3-methyl-2-butenyl)-1H-indol-3-yl]methylene]-6-methylene-2,5-piperazinedione | ||
|---|---|---|---|---|
| CAS Number | 55179-54-9 | Molecular Weight | 389.49000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H27N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (3Z)-3-[[2-(1,1-Dimethyl-2-propenyl)-6-(3-methyl-2-butenyl)-1H-indol-3-yl]methylene]-6-methylene-2,5-piperazinedioneNeoechinulin C, an echinulin-related indolediketopiperazine alkaloid, protects the neuronal cells against paraquat-induced damage in a Parkinson’s disease model[1]. |
| Name | 3-[2-(1,1-dimethyl-allyl)-6-(3-methyl-but-2-enyl)-indol-3-ylmethylene]-6-methylene-piperazine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Neoechinulin C, an echinulin-related indolediketopiperazine alkaloid, protects the neuronal cells against paraquat-induced damage in a Parkinson’s disease model[1]. |
|---|---|
| Related Catalog | |
| Target |
Microbial Metabolite |
| References |
| Molecular Formula | C24H27N3O2 |
|---|---|
| Molecular Weight | 389.49000 |
| Exact Mass | 389.21000 |
| PSA | 81.51000 |
| LogP | 2.75590 |
| InChIKey | WXWNIBJUIDHOOC-MOSHPQCFSA-N |
| SMILES | C=CC(C)(C)c1[nH]c2cc(CC=C(C)C)ccc2c1C=c1[nH]c(=O)c(=C)[nH]c1=O |
| Cryptoechinulin A |
| Neoechinulin C |
| Kryptoechinulin A |
| 3-[1-[2-(1,1-Dimethyl-allyl)-6-(3-methyl-but-2-enyl)-1H-indol-3-yl]-meth-(Z)-ylidene]-6-methylene-piperazine-2,5-dione |