calcium triflate structure
|
Common Name | calcium triflate | ||
|---|---|---|---|---|
| CAS Number | 55120-75-7 | Molecular Weight | 338.216 | |
| Density | N/A | Boiling Point | 162ºC at 760 mmHg | |
| Molecular Formula | C2CaF6O6S2 | Melting Point | 350 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | Calcium Trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 162ºC at 760 mmHg |
|---|---|
| Melting Point | 350 °C(lit.) |
| Molecular Formula | C2CaF6O6S2 |
| Molecular Weight | 338.216 |
| Exact Mass | 337.866638 |
| PSA | 131.16000 |
| LogP | 2.26440 |
| InChIKey | PUQLFUHLKNBKQQ-UHFFFAOYSA-L |
| SMILES | O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Ca+2] |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S27-S36/37/39-S45 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| Hazard Class | 8.0 |
| HS Code | 2904909090 |
|
~98%
calcium triflate CAS#:55120-75-7 |
| Literature: Sugita, Keisuke; Ohta, Akihisa; Onaka, Makoto; Izumi, Yusuke Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 6 p. 1792 - 1799 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00143911 |
| Methanesulfonic acid, 1,1,1-trifluoro-, calcium salt (2:1) |
| EINECS 232-188-7 |
| calcium,trifluoromethanesulfonate |
| Calcium bis(trifluoromethanesulfonate) |
| calcium triflate |
| Calcium trifluoromethanesulfonate |