propicillin structure
|
Common Name | propicillin | ||
|---|---|---|---|---|
| CAS Number | 551-27-9 | Molecular Weight | 378.44300 | |
| Density | 1.38g/cm3 | Boiling Point | 675.5ºC at 760mmHg | |
| Molecular Formula | C18H22N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 362.3ºC | |
| Name | propicillin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 675.5ºC at 760mmHg |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.44300 |
| Flash Point | 362.3ºC |
| Exact Mass | 378.12500 |
| PSA | 124.73000 |
| LogP | 2.25390 |
| Index of Refraction | 1.628 |
| InChIKey | HOCWPKXKMNXINF-XQERAMJGSA-N |
| SMILES | CCC(Oc1ccccc1)C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)O |
|
~%
propicillin CAS#:551-27-9 |
| Literature: Perron,Y.G. et al. Journal of the American Chemical Society, 1960 , vol. 82, p. 3934 - 3938 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-[(2-phenoxybutanoyl)amino]-4-thia -1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| A-pimaric acid |
| B-Pimaric Acid |