2-(2-hydroxyethyl)-5-nitroisoindole-1,3-dione structure
|
Common Name | 2-(2-hydroxyethyl)-5-nitroisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 55080-96-1 | Molecular Weight | 236.18100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-hydroxyethyl)-5-nitroisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8N2O5 |
|---|---|
| Molecular Weight | 236.18100 |
| Exact Mass | 236.04300 |
| PSA | 103.43000 |
| LogP | 0.64420 |
| InChIKey | WQVLISNHYKCNPD-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CCO |
|
~%
2-(2-hydroxyeth... CAS#:55080-96-1 |
| Literature: Eastman Kodak Company Patent: US4324719 A1, 1982 ; |
|
~%
2-(2-hydroxyeth... CAS#:55080-96-1 |
| Literature: Soine Journal of the American Pharmaceutical Association (1912-1977), 1946 , vol. 35, p. 42 |
| 2-(2-hydroxy-ethyl)-5-nitro-isoindoline-1,3-dione |
| N-(2-Hydroxyethyl)-4-nitrophthalimid |
| N-(2-hydroxyethyl)-4-nitrophthalimide |
| 2-(2-Hydroxyethyl)-5-nitro-1H-isoindole-1,3(2H)-dione |
| 2-(2-Hydroxy-aethyl)-5-nitro-isoindolin-1,3-dion |