N-(4-bromophenyl)-3-(diethylamino)propanamide
Modify Date: 2024-01-05 18:04:45
N-(4-bromophenyl)-3-(diethylamino)propanamide structure
|
Common Name | N-(4-bromophenyl)-3-(diethylamino)propanamide | ||
|---|---|---|---|---|
| CAS Number | 55042-47-2 | Molecular Weight | 299.20700 | |
| Density | 1.309g/cm3 | Boiling Point | 416.5ºC at 760 mmHg | |
| Molecular Formula | C13H19BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.7ºC | |
| Name | N-(4-bromophenyl)-3-(diethylamino)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 416.5ºC at 760 mmHg |
| Molecular Formula | C13H19BrN2O |
| Molecular Weight | 299.20700 |
| Flash Point | 205.7ºC |
| Exact Mass | 298.06800 |
| PSA | 32.34000 |
| LogP | 3.19250 |
| Index of Refraction | 1.571 |
| InChIKey | NUSHRIGBDGMKJF-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCC(=O)Nc1ccc(Br)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Propanamide,N-(4-bromophenyl)-3-(diethylamino) |