N-(4-BROMOPHENYL)-3-CHLOROPROPIONAMIDE
Modify Date: 2024-01-04 01:42:46
N-(4-BROMOPHENYL)-3-CHLOROPROPIONAMIDE structure
|
Common Name | N-(4-BROMOPHENYL)-3-CHLOROPROPIONAMIDE | ||
|---|---|---|---|---|
| CAS Number | 19205-70-0 | Molecular Weight | 262.53100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9BrClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-Bromophenyl)-3-chloropropanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9BrClNO |
|---|---|
| Molecular Weight | 262.53100 |
| Exact Mass | 260.95600 |
| PSA | 29.10000 |
| LogP | 3.08950 |
| HS Code | 2924299090 |
|---|
|
~%
N-(4-BROMOPHENY... CAS#:19205-70-0 |
| Literature: Harris, Stephen J.; Kinahan, Audrey M.; Meegan, Mary J.; Prendergast, Rhona C. Journal of Chemical Research, Miniprint, 1994 , # 9 p. 1832 - 1845 |
|
~%
N-(4-BROMOPHENY... CAS#:19205-70-0 |
| Literature: Pohloudek-Fabini; Schroepl Die Pharmazie, 1968 , vol. 23, # 10 p. 561 - 566 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:7661-25-8| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(3-Chlor-propionylamino)-1-brom-benzol |
| N-(4-Bromo-phenyl)-3-chloro-propionamide |
| N-(4-Brom-phenyl)-3-chlor-propionsaeureamid |
| Propanamide,N-(4-bromophenyl)-3-chloro |
| N-<3-Chlor-propionyl>-4-brom-anilin |