1-methyl-4-[3-[3-(4-methylphenyl)sulfonyloxypropoxy]propoxysulfonyl]benzene structure
|
Common Name | 1-methyl-4-[3-[3-(4-methylphenyl)sulfonyloxypropoxy]propoxysulfonyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 55005-96-4 | Molecular Weight | 442.54600 | |
| Density | 1.258g/cm3 | Boiling Point | 598.3ºC at 760 mmHg | |
| Molecular Formula | C20H26O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.7ºC | |
| Name | 3-[3-(4-methylphenyl)sulfonyloxypropoxy]propyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 598.3ºC at 760 mmHg |
| Molecular Formula | C20H26O7S2 |
| Molecular Weight | 442.54600 |
| Flash Point | 315.7ºC |
| Exact Mass | 442.11200 |
| PSA | 112.73000 |
| LogP | 5.37260 |
| Index of Refraction | 1.546 |
| InChIKey | KHUGAMZTNKBNFW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCCOCCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
|
~45%
1-methyl-4-[3-[... CAS#:55005-96-4 |
| Literature: Bradshaw; Guynn; Wood; et al. Journal of Heterocyclic Chemistry, 1987 , vol. 24, # 2 p. 415 - 419 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-oxaheptane-1,7-ditosylate |