N,N'-bis(2,4-dinitrophenyl)hexane-1,6-diamine
Modify Date: 2025-08-26 07:31:01
N,N'-bis(2,4-dinitrophenyl)hexane-1,6-diamine structure
|
Common Name | N,N'-bis(2,4-dinitrophenyl)hexane-1,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 54897-75-5 | Molecular Weight | 448.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20N6O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-bis(2,4-dinitrophenyl)hexane-1,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H20N6O8 |
|---|---|
| Molecular Weight | 448.38700 |
| Exact Mass | 448.13400 |
| PSA | 207.34000 |
| LogP | 6.64260 |
| InChIKey | YNFDBECNMFCIMN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NCCCCCCNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
|
~%
N,N'-bis(2,4-di... CAS#:54897-75-5 |
| Literature: Johnson Journal of the Chemical Society, 1958 , p. 1624,1625,1626 |
|
~%
N,N'-bis(2,4-di... CAS#:54897-75-5 |
| Literature: Zahn; Kocklaenner Zeitschrift fuer Analytische Chemie, 1954 , vol. 141, p. 183,186 |
|
~%
N,N'-bis(2,4-di... CAS#:54897-75-5 |
| Literature: Giua; Musso Gazzetta Chimica Italiana, 1954 , vol. 84, p. 1114 |
| N~1~,N~6~-bis(2,4-dinitrophenyl)-1,6-hexanediamine |
| N,N'-bis-(2,4-dinitro-phenyl)-hexanediyldiamine |
| N,N'-Bis-(2,4-dinitro-phenyl)-hexandiyldiamin |
| 1,6-Hexanediamine,N,N'-bis(2,4-dinitrophenyl) |
| CL 3052 |