Fexofenadine D6 structure
|
Common Name | Fexofenadine D6 | ||
|---|---|---|---|---|
| CAS Number | 548783-71-7 | Molecular Weight | 507.69300 | |
| Density | 1.186g/cm3 | Boiling Point | 697.261ºC at 760 mmHg | |
| Molecular Formula | C32H33D6NO4 | Melting Point | 193-196ºC | |
| MSDS | N/A | Flash Point | 375.49ºC | |
Use of Fexofenadine D6Fexofenadine D6 is deuterium labeled is Fexofenadine, which is an antihistamine pharmaceutical drug. |
| Name | 3,3,3-trideuterio-2-[4-[1-hydroxy-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]phenyl]-2-(trideuteriomethyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fexofenadine D6 is deuterium labeled is Fexofenadine, which is an antihistamine pharmaceutical drug. |
|---|---|
| Related Catalog |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 697.261ºC at 760 mmHg |
| Melting Point | 193-196ºC |
| Molecular Formula | C32H33D6NO4 |
| Molecular Weight | 507.69300 |
| Flash Point | 375.49ºC |
| Exact Mass | 507.32600 |
| PSA | 81.00000 |
| LogP | 5.44840 |
| Index of Refraction | 1.597 |
| InChIKey | RWTNPBWLLIMQHL-WFGJKAKNSA-N |
| SMILES | CC(C)(C(=O)O)c1ccc(C(O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| Storage condition | 2-8℃ |
| Terfenadine-d6 Carboxylate |
| Fexofenadine-d6 |
| Terfenadine-d6 Acid Metabolite |
| Carboxyterfenadine-d6 |
| Fexofenadine D6 |