Cornin structure
|
Common Name | Cornin | ||
|---|---|---|---|---|
| CAS Number | 548-37-8 | Molecular Weight | 388.366 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 610.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H24O10 | Melting Point | 180-182ºC | |
| MSDS | Chinese USA | Flash Point | 219.4±25.0 °C | |
Use of CorninVerbenalin is Verbena glycoside, with anti-inflammatory, anti-fungal anti-virus activities. Verbenalin has a good effect on prostatitis. Verbenalin can reduce cerebral ischemia-reperfusion injury[1][2]. |
| Name | verbenalin |
|---|---|
| Synonym | More Synonyms |
| Description | Verbenalin is Verbena glycoside, with anti-inflammatory, anti-fungal anti-virus activities. Verbenalin has a good effect on prostatitis. Verbenalin can reduce cerebral ischemia-reperfusion injury[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 610.1±55.0 °C at 760 mmHg |
| Melting Point | 180-182ºC |
| Molecular Formula | C17H24O10 |
| Molecular Weight | 388.366 |
| Flash Point | 219.4±25.0 °C |
| Exact Mass | 388.136932 |
| PSA | 151.98000 |
| LogP | -2.39 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | HLXRWTJXGMHOFN-XJSNKYLASA-N |
| SMILES | COC(=O)C1=COC(OC2OC(CO)C(O)C(O)C2O)C2C(C)CC(=O)C12 |
| Storage condition | 2-8C |
| Safety Phrases | S22 |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | GY5826000 |
| Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-7-methyl-5-oxo-, methyl ester, (1S,4aS,7S,7aR)- |
| Methyl (1S,4aS,7S,7aR)-1-(β-D-glucopyranosyloxy)-7-methyl-5-oxo-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| Verbenaline |
| Verbenalinp |
| CORNIN |
| VERBENALOSIDE |